100% FREE Updated: Apr 2026 Linear Algebra Vector Spaces and System Properties

Basis and Dimension

Comprehensive study notes on Basis and Dimension for ISI MS(QMBA) preparation. This chapter covers key concepts, formulas, and examples needed for your exam.

Basis and Dimension

Overview

Welcome to the chapter on Basis and Dimension, a cornerstone of Linear Algebra that provides the essential tools for understanding the structure and properties of vector spaces. This chapter moves beyond individual vectors and operations, equipping you with the concepts to describe the fundamental building blocks and inherent 'size' of any vector space. Mastering these ideas is not just about memorizing definitions; it's about developing a profound intuition for how vector spaces work, which is indispensable for advanced topics.

For the ISI MSQMS entrance examination, a solid grasp of Basis and Dimension is absolutely critical. You can expect direct questions testing your ability to determine linear independence, find a basis for various vector spaces (like column space, null space, row space), and calculate their dimensions. Beyond direct questions, these concepts underpin problem-solving in areas such as systems of linear equations, eigenvalues and eigenvectors, and linear transformations – all frequently tested topics.

A deep understanding of this chapter will enable you to simplify complex problems, identify redundant information, and efficiently represent vectors. It forms the analytical framework required to tackle the quantitative challenges posed by the MSQMS syllabus, providing the conceptual clarity needed for both theoretical questions and practical applications in fields like optimization, statistics, and econometrics.

---

Chapter Contents

| # | Topic | What You'll Learn |
|---|-------|-------------------|
| 1 | Linear Independence and Dependence | Identify redundant vectors in a set. |
| 2 | Basis of a Vector Space | Construct minimal spanning sets. |
| 3 | Dimension | Determine the 'size' of a space. |

---

Learning Objectives

By the End of This Chapter

After studying this chapter, you will be able to:

  • Distinguish between linearly independent and dependent sets of vectors.

  • Define and identify a basis for a given vector space or subspace WVW \subseteq V.

  • Compute the dimension of various vector spaces and subspaces, including Col(A)\text{Col}(A), Nul(A)\text{Nul}(A), and Row(A)\text{Row}(A).

  • Apply the concepts of basis and dimension to analyze properties of matrices and linear transformations.

---

Now let's begin with Linear Independence and Dependence...

Part 1: Linear Independence and Dependence

Introduction

Linear independence and dependence are fundamental concepts in linear algebra, crucial for understanding the structure of vector spaces. They help us determine whether a set of vectors contains redundant information or if each vector contributes uniquely to the span of the set. This understanding is vital for defining a basis, which forms the building blocks of any vector space, and subsequently, its dimension. Mastering these ideas is a prerequisite for advanced topics in vector spaces.
📖 Linear Combination

A vector vv is a linear combination of vectors v1,v2,,vkv_1, v_2, \ldots, v_k if it can be expressed in the form:

v=c1v1+c2v2++ckvkv = c_1v_1 + c_2v_2 + \ldots + c_kv_k

where c1,c2,,ckc_1, c_2, \ldots, c_k are scalars.

---

Key Concepts

1. Linear Independence

A set of vectors is linearly independent if no vector in the set can be written as a linear combination of the others. This means each vector introduces a "new direction" to the set's span.

📖 Linearly Independent Set

A set of vectors {v1,v2,,vk}\{v_1, v_2, \ldots, v_k\} in a vector space VV is said to be linearly independent if the only solution to the vector equation:

c1v1+c2v2++ckvk=0c_1v_1 + c_2v_2 + \ldots + c_kv_k = 0

is the trivial solution, i.e., c1=c2==ck=0c_1 = c_2 = \ldots = c_k = 0.

Implication: If a set of vectors is linearly independent, then removing any vector from the set would reduce the span of the set.

---

2. Linear Dependence

A set of vectors is linearly dependent if at least one vector in the set can be expressed as a linear combination of the others. This implies there is some redundancy within the set.

📖 Linearly Dependent Set

A set of vectors {v1,v2,,vk}\{v_1, v_2, \ldots, v_k\} in a vector space VV is said to be linearly dependent if there exist scalars c1,c2,,ckc_1, c_2, \ldots, c_k, not all zero, such that:

c1v1+c2v2++ckvk=0c_1v_1 + c_2v_2 + \ldots + c_kv_k = 0

Implication: If a set of vectors is linearly dependent, then at least one vector can be written as a linear combination of the others. Removing such a vector would not change the span of the set.

---

3. Testing for Linear Independence/Dependence

To determine if a set of vectors {v1,v2,,vk}\{v_1, v_2, \ldots, v_k\} is linearly independent or dependent, we set up the vector equation c1v1+c2v2++ckvk=0c_1v_1 + c_2v_2 + \ldots + c_kv_k = 0 and solve for the scalars c1,,ckc_1, \ldots, c_k.

Method:

  • Form the vector equation: c1v1+c2v2++ckvk=0c_1v_1 + c_2v_2 + \ldots + c_kv_k = 0.

  • Write this equation as a homogeneous system of linear equations. If viv_i are column vectors, this can be written as a matrix equation Ac=0Ac = 0, where A=[v1v2vk]A = [v_1 | v_2 | \ldots | v_k] and c=[c1,c2,,ck]Tc = [c_1, c_2, \ldots, c_k]^T.

  • Solve the system using methods like Gaussian elimination (row reduction).

  • * If the only solution is c1=c2==ck=0c_1 = c_2 = \ldots = c_k = 0 (the trivial solution), the vectors are linearly independent.
    * If there are non-trivial solutions (i.e., at least one ci0c_i \neq 0), the vectors are linearly dependent.

    Key Property
      • A set containing the zero vector is always linearly dependent.
      • A set containing a single non-zero vector is linearly independent.
      • If a set of vectors in Rn\mathbb{R}^n contains more than nn vectors, it is always linearly dependent.

    Worked Example:

    Problem: Determine if the vectors v1=(12)v_1 = \begin{pmatrix} 1 \\ 2 \end{pmatrix} and v2=(24)v_2 = \begin{pmatrix} 2 \\ 4 \end{pmatrix} are linearly independent in R2\mathbb{R}^2.

    Solution:

    Step 1: Set up the vector equation c1v1+c2v2=0c_1v_1 + c_2v_2 = 0.

    c1(12)+c2(24)=(00)c_1 \begin{pmatrix} 1 \\ 2 \end{pmatrix} + c_2 \begin{pmatrix} 2 \\ 4 \end{pmatrix} = \begin{pmatrix} 0 \\ 0 \end{pmatrix}

    Step 2: Form the homogeneous system of linear equations.

    c1+2c2=0c_1 + 2c_2 = 0
    2c1+4c2=02c_1 + 4c_2 = 0

    Step 3: Solve the system. From the first equation, c1=2c2c_1 = -2c_2. Substitute this into the second equation.

    2(2c2)+4c2=02(-2c_2) + 4c_2 = 0
    4c2+4c2=0-4c_2 + 4c_2 = 0
    0=00 = 0

    This implies that c2c_2 can be any real number, and c1c_1 will be 2c2-2c_2. For instance, if we choose c2=1c_2 = 1, then c1=2c_1 = -2.

    Step 4: Conclude based on the solution. Since there exist non-trivial solutions (e.g., c1=2,c2=1c_1=-2, c_2=1), the vectors are linearly dependent.

    Answer: The vectors v1v_1 and v2v_2 are linearly dependent.

    ---

    Problem-Solving Strategies

    💡 ISI Strategy

    When testing for linear independence:

    • Form a matrix: Arrange the vectors as columns of a matrix AA.

    • Row Reduce: Perform Gaussian elimination on AA to its row echelon form.

    • Analyze Pivots:

    If every column has a pivot (i.e., the rank of AA is equal to the number of vectors), then the only solution to Ac=0Ac=0 is the trivial solution, and the vectors are linearly independent.
    If there is at least one column without a pivot (a free variable exists), then there are non-trivial solutions, and the vectors are linearly dependent.

    ---

    Common Mistakes

    ⚠️ Avoid These Errors
      • Confusing trivial solution with linear dependence: Students sometimes mistake the existence of a 00 on the right side of c1v1+=0c_1v_1 + \ldots = 0 as meaning dependence.
    Correct approach: The key is whether c1,,ckc_1, \ldots, c_k must all be zero. If they must be, it's independence. If other values are possible, it's dependence.
      • Assuming vectors are independent if they are "different": Just because vectors look different does not guarantee linear independence. For example, (10)\begin{pmatrix} 1 \\ 0 \end{pmatrix} and (20)\begin{pmatrix} 2 \\ 0 \end{pmatrix} are different but linearly dependent.
    Correct approach: Always apply the formal definition by setting up and solving the homogeneous system.

    ---

    Practice Questions

    :::question type="MCQ" question="Which of the following sets of vectors is linearly independent in R2\mathbb{R}^2?" options=["A. {(10),(20)}\left\{ \begin{pmatrix} 1 \\ 0 \end{pmatrix}, \begin{pmatrix} 2 \\ 0 \end{pmatrix} \right\}","B. {(11),(22)}\left\{ \begin{pmatrix} 1 \\ 1 \end{pmatrix}, \begin{pmatrix} 2 \\ 2 \end{pmatrix} \right\}","C. {(10),(01)}\left\{ \begin{pmatrix} 1 \\ 0 \end{pmatrix}, \begin{pmatrix} 0 \\ 1 \end{pmatrix} \right\}","D. {(00),(11)}\left\{ \begin{pmatrix} 0 \\ 0 \end{pmatrix}, \begin{pmatrix} 1 \\ 1 \end{pmatrix} \right\}"] answer="C. {(10),(01)}\left\{ \begin{pmatrix} 1 \\ 0 \end{pmatrix}, \begin{pmatrix} 0 \\ 1 \end{pmatrix} \right\}" hint="A set containing the zero vector is always dependent. For two non-zero vectors, check if one is a scalar multiple of the other." solution="Let's check each option:
    A. (20)=2(10)\begin{pmatrix} 2 \\ 0 \end{pmatrix} = 2 \begin{pmatrix} 1 \\ 0 \end{pmatrix}. Dependent.
    B. (22)=2(11)\begin{pmatrix} 2 \\ 2 \end{pmatrix} = 2 \begin{pmatrix} 1 \\ 1 \end{pmatrix}. Dependent.
    C. Let c1(10)+c2(01)=(00)c_1 \begin{pmatrix} 1 \\ 0 \end{pmatrix} + c_2 \begin{pmatrix} 0 \\ 1 \end{pmatrix} = \begin{pmatrix} 0 \\ 0 \end{pmatrix}. This gives c1=0c_1 = 0 and c2=0c_2 = 0. Only the trivial solution exists. Independent.
    D. The set contains the zero vector (00)\begin{pmatrix} 0 \\ 0 \end{pmatrix}, so it is linearly dependent.
    Therefore, option C is the correct answer."
    :::

    :::question type="NAT" question="Consider the vectors v1=(101)v_1 = \begin{pmatrix} 1 \\ 0 \\ 1 \end{pmatrix}, v2=(011)v_2 = \begin{pmatrix} 0 \\ 1 \\ 1 \end{pmatrix}, and v3=(11k)v_3 = \begin{pmatrix} 1 \\ 1 \\ k \end{pmatrix} in R3\mathbb{R}^3. For what value of kk are these vectors linearly dependent?" answer="2" hint="Form a matrix with these vectors as columns and find kk such that the determinant is zero, or such that the system Ac=0Ac=0 has non-trivial solutions." solution="For the vectors to be linearly dependent, the determinant of the matrix formed by these vectors must be zero.

    A=(10101111k)A = \begin{pmatrix} 1 & 0 & 1 \\ 0 & 1 & 1 \\ 1 & 1 & k \end{pmatrix}

    Calculate the determinant:
    det(A)=1(1k11)0()+1(0111)\det(A) = 1(1 \cdot k - 1 \cdot 1) - 0(\ldots) + 1(0 \cdot 1 - 1 \cdot 1)

    det(A)=(k1)+(1)\det(A) = (k - 1) + (-1)

    det(A)=k2\det(A) = k - 2

    For linear dependence, det(A)=0\det(A) = 0.
    k2=0k - 2 = 0

    k=2k = 2

    Thus, for k=2k=2, the vectors are linearly dependent."
    :::

    :::question type="MSQ" question="Let S={v1,v2,v3}S = \{v_1, v_2, v_3\} be a set of vectors in a vector space VV. Which of the following statements are true?" options=["A. If SS is linearly independent, then any subset of SS is also linearly independent.","B. If SS is linearly dependent, then v1v_1 must be a linear combination of v2v_2 and v3v_3.","C. If v1=0v_1 = 0, then SS is linearly dependent.","D. If v2=2v1v_2 = 2v_1, then SS is linearly independent."] answer="A,C" hint="Carefully consider the definitions of linear independence and dependence. For option B, think about which vector can be written as a linear combination of others when the set is dependent." solution="Let's analyze each option:
    A. If SS is linearly independent, then no vector in SS is a linear combination of others. Any subset of SS will also satisfy this condition, as there are even fewer vectors to form combinations from. So, this is TRUE.
    B. If SS is linearly dependent, there exist scalars c1,c2,c3c_1, c_2, c_3, not all zero, such that c1v1+c2v2+c3v3=0c_1v_1 + c_2v_2 + c_3v_3 = 0. If c10c_1 \neq 0, then v1v_1 can be written as a linear combination of v2v_2 and v3v_3. However, it's also possible that c1=0c_1=0 but c20c_2 \neq 0 (e.g., v2=2v3v_2 = 2v_3). In this case, v1v_1 might not be a linear combination of v2v_2 and v3v_3. The statement says v1v_1 must be, which is false. For example, if v1,v2v_1, v_2 are dependent and v3v_3 is independent of v1,v2v_1, v_2, then v1v_1 could be a multiple of v2v_2, but v3v_3 is not involved. So, this is FALSE.
    C. If v1=0v_1 = 0, then we can choose c1=1c_1 = 1, and c2=0c_2 = 0, c3=0c_3 = 0. Then 1v1+0v2+0v3=10+0+0=01 \cdot v_1 + 0 \cdot v_2 + 0 \cdot v_3 = 1 \cdot 0 + 0 + 0 = 0. Since we found scalars not all zero (specifically c1=1c_1=1) that satisfy the equation, the set is linearly dependent. So, this is TRUE.
    D. If v2=2v1v_2 = 2v_1, then we can write 2v1v2+0v3=02v_1 - v_2 + 0v_3 = 0. Here, c1=2,c2=1,c3=0c_1=2, c_2=-1, c_3=0 are not all zero. Thus, the set is linearly dependent. The statement says it is linearly independent, which is false. So, this is FALSE.
    The correct options are A and C."
    :::

    ---

    Summary

    Key Takeaways for ISI

    • Linear Independence: A set of vectors {v1,,vk}\{v_1, \ldots, v_k\} is linearly independent if c1v1++ckvk=0c_1v_1 + \ldots + c_kv_k = 0 implies c1==ck=0c_1 = \ldots = c_k = 0.

    • Linear Dependence: A set of vectors {v1,,vk}\{v_1, \ldots, v_k\} is linearly dependent if c1v1++ckvk=0c_1v_1 + \ldots + c_kv_k = 0 has at least one solution where not all cic_i are zero.

    • Testing Method: Set up the homogeneous system Ac=0Ac=0 (where columns of AA are the vectors) and determine if it has only the trivial solution (independent) or also non-trivial solutions (dependent).

    • Special Cases: A set containing the zero vector is always dependent. If the number of vectors exceeds the dimension of the space, they are dependent.

    ---

    What's Next?

    💡 Continue Learning

    This topic connects to:

      • Span of a Set: Understanding linear independence helps identify minimal sets that span a vector space.

      • Basis of a Vector Space: A basis is a linearly independent set that also spans the entire vector space. This is a direct application of linear independence.

      • Dimension of a Vector Space: The dimension is the number of vectors in any basis, which relies on the concept of linear independence.


    Master these connections for comprehensive ISI preparation!

    ---

    💡 Moving Forward

    Now that you understand Linear Independence and Dependence, let's explore Basis of a Vector Space which builds on these concepts.

    ---

    Part 2: Basis of a Vector Space

    Introduction

    In the study of vector spaces, understanding the concept of a basis is fundamental. A basis provides a minimal set of vectors that can describe every other vector in the space. It acts like a coordinate system, allowing us to uniquely represent any vector as a linear combination of the basis vectors. This concept is crucial for understanding the structure and properties of vector spaces, including their dimension.
    📖 Vector Space

    A vector space VV over a field FF is a set equipped with two operations, vector addition and scalar multiplication, satisfying specific axioms.

    ---

    Key Concepts

    1. Linear Independence

    A set of vectors is linearly independent if no vector in the set can be written as a linear combination of the others. This means there's no redundancy among the vectors.

    📖 Linear Independence

    A set of vectors {v1,v2,,vk}\{v_1, v_2, \ldots, v_k\} in a vector space VV is said to be linearly independent if the only solution to the vector equation

    c1v1+c2v2++ckvk=0c_1v_1 + c_2v_2 + \ldots + c_kv_k = \mathbf{0}

    is the trivial solution c1=c2==ck=0c_1 = c_2 = \ldots = c_k = 0.
    If there exists a non-trivial solution (i.e., at least one ci0c_i \neq 0), the set is linearly dependent.

    How to check for Linear Independence:
    Form a matrix with the vectors as columns (or rows) and find its rank or determinant.

    • If the determinant of the square matrix formed by the vectors is non-zero, the vectors are linearly independent.

    • If the rank of the matrix is equal to the number of vectors, they are linearly independent.


    ---

    2. Spanning Set

    A set of vectors spans a vector space if every vector in the space can be expressed as a linear combination of the vectors in the set. This means the set "generates" the entire space.

    📖 Spanning Set

    A set of vectors {v1,v2,,vk}\{v_1, v_2, \ldots, v_k\} in a vector space VV is said to span (or generate) VV if every vector uVu \in V can be written as a linear combination of v1,v2,,vkv_1, v_2, \ldots, v_k.
    That is, for every uVu \in V, there exist scalars c1,c2,,ckc_1, c_2, \ldots, c_k such that

    u=c1v1+c2v2++ckvku = c_1v_1 + c_2v_2 + \ldots + c_kv_k

    The set of all such linear combinations is called the span of {v1,,vk}\{v_1, \ldots, v_k\}, denoted as span{v1,,vk}\text{span}\{v_1, \ldots, v_k\}.

    How to check if a set spans VV:
    For a vector space VV of dimension nn, if you have nn vectors, they span VV if and only if they are linearly independent. If you have more than nn vectors, they might span VV but will be linearly dependent. If you have fewer than nn vectors, they cannot span VV.

    ---

    3. Basis of a Vector Space

    A basis is a set of vectors that is both linearly independent and spans the entire vector space. It is the most efficient set to describe the space.

    📖 Basis of a Vector Space

    A set of vectors B={v1,v2,,vn}\mathcal{B} = \{v_1, v_2, \ldots, v_n\} in a vector space VV is called a basis for VV if both of the following conditions hold:

    • B\mathcal{B} is linearly independent.

    • B\mathcal{B} spans VV.

    Properties of a Basis:

    • Every vector in VV can be expressed as a unique linear combination of the basis vectors.

    • Any two bases for the same vector space VV have the same number of vectors.


    Standard Bases:
    • For Rn\mathbb{R}^n, the standard basis is {e1,e2,,en}\{e_1, e_2, \ldots, e_n\}, where eie_i is a vector with 1 in the ii-th position and 0 elsewhere.

    For R2\mathbb{R}^2, it's {(1,0),(0,1)}\{(1,0), (0,1)\}.
    For R3\mathbb{R}^3, it's {(1,0,0),(0,1,0),(0,0,1)}\{(1,0,0), (0,1,0), (0,0,1)\}.
    • For PnP_n (the vector space of polynomials of degree at most nn), the standard basis is {1,x,x2,,xn}\{1, x, x^2, \ldots, x^n\}.

    • For Mm×nM_{m \times n} (the vector space of m×nm \times n matrices), the standard basis consists of matrices with a single 1 and all other entries 0.


    ---

    4. Dimension of a Vector Space

    The dimension of a vector space is a fundamental property that quantifies its "size" or number of independent directions.

    📖 Dimension of a Vector Space

    The dimension of a vector space VV, denoted by dim(V)\text{dim}(V), is the number of vectors in any basis for VV.
    If V={0}V = \{\mathbf{0}\}, then dim(V)=0\text{dim}(V) = 0.
    If a vector space does not have a finite basis, it is called an infinite-dimensional vector space.

    Examples:

    • dim(Rn)=n\text{dim}(\mathbb{R}^n) = n

    • dim(Pn)=n+1\text{dim}(P_n) = n+1

    • dim(Mm×n)=mn\text{dim}(M_{m \times n}) = mn


    ---

    5. Coordinate Vectors

    Once a basis is chosen for a vector space, any vector in that space can be uniquely represented by a coordinate vector relative to that basis.

    📖 Coordinate Vector

    Let B={v1,v2,,vn}\mathcal{B} = \{v_1, v_2, \ldots, v_n\} be an ordered basis for a vector space VV. For any vector uVu \in V, there exist unique scalars c1,c2,,cnc_1, c_2, \ldots, c_n such that

    u=c1v1+c2v2++cnvnu = c_1v_1 + c_2v_2 + \ldots + c_nv_n

    The coordinate vector of uu relative to B\mathcal{B} is the column vector [u]B[u]_{\mathcal{B}} defined as:
    [u]B=(c1c2cn)[u]_{\mathcal{B}} = \begin{pmatrix} c_1 \\ c_2 \\ \vdots \\ c_n \end{pmatrix}

    Worked Example:

    Problem: Determine if the set B={(1,2),(3,4)}\mathcal{B} = \{(1, 2), (3, 4)\} is a basis for R2\mathbb{R}^2.

    Solution:

    Step 1: Check for linear independence.
    We need to find scalars c1,c2c_1, c_2 such that c1(1,2)+c2(3,4)=(0,0)c_1(1, 2) + c_2(3, 4) = (0, 0).
    This leads to the system of equations:

    c1+3c2=0c_1 + 3c_2 = 0

    2c1+4c2=02c_1 + 4c_2 = 0

    Step 2: Solve the system.
    From the first equation, c1=3c2c_1 = -3c_2. Substitute into the second equation:

    2(3c2)+4c2=02(-3c_2) + 4c_2 = 0

    6c2+4c2=0-6c_2 + 4c_2 = 0

    2c2=0-2c_2 = 0

    c2=0c_2 = 0

    Substituting c2=0c_2 = 0 back into c1=3c2c_1 = -3c_2, we get c1=0c_1 = 0.
    Since the only solution is c1=0,c2=0c_1 = 0, c_2 = 0, the set B\mathcal{B} is linearly independent.

    Step 3: Check if B\mathcal{B} spans R2\mathbb{R}^2.
    Since dim(R2)=2\text{dim}(\mathbb{R}^2) = 2 and B\mathcal{B} contains 2 linearly independent vectors, it must span R2\mathbb{R}^2.
    (Alternatively, form a matrix with the vectors as columns: (1324)\begin{pmatrix} 1 & 3 \\ 2 & 4 \end{pmatrix}. Its determinant is 1432=46=201 \cdot 4 - 3 \cdot 2 = 4 - 6 = -2 \neq 0. A non-zero determinant implies the vectors are linearly independent and span R2\mathbb{R}^2.)

    Answer: Yes, the set B={(1,2),(3,4)}\mathcal{B} = \{(1, 2), (3, 4)\} is a basis for R2\mathbb{R}^2.

    ---

    Problem-Solving Strategies

    💡 Verifying a Basis

    To check if a set of nn vectors {v1,,vn}\{v_1, \ldots, v_n\} is a basis for a vector space VV of dimension nn:

    • If dim(V)=n\text{dim}(V) = n: You only need to check either linear independence or spanning. If one holds, the other automatically holds.

    • General Case: Always check both linear independence and spanning.

    - Linear Independence: Set c1v1++cnvn=0c_1v_1 + \ldots + c_nv_n = \mathbf{0} and solve for cic_i. If only trivial solution, independent.
    - Spanning: Show that for any arbitrary vector uVu \in V, u=c1v1++cnvnu = c_1v_1 + \ldots + c_nv_n has a solution for cic_i.

    ---

    Common Mistakes

    ⚠️ Avoid These Errors
      • ❌ Assuming a set of nn vectors is a basis for an nn-dimensional space without checking linear independence.
    ✅ Always verify linear independence (or spanning) for a set of nn vectors in an nn-dimensional space.
      • ❌ Confusing the dimension of a polynomial space PnP_n (degree at most nn) as nn.
    ✅ The dimension of PnP_n is n+1n+1 because it includes the constant term (e.g., {1,x,x2,,xn}\{1, x, x^2, \ldots, x^n\}).
      • ❌ Not ensuring the basis vectors are from the specified vector space.
    ✅ Always confirm that the candidate basis vectors belong to the vector space for which you are trying to form a basis.

    ---

    Practice Questions

    :::question type="MCQ" question="Which of the following sets is a basis for R3\mathbb{R}^3?" options=["A. {(1,0,0),(0,1,0)}\{(1,0,0), (0,1,0)\}","B. {(1,1,0),(0,1,1),(1,0,1)}\{(1,1,0), (0,1,1), (1,0,-1)\}","C. {(1,0,0),(0,1,0),(0,0,0)}\{(1,0,0), (0,1,0), (0,0,0)\}","D. {(1,2,3),(4,5,6),(7,8,9),(10,11,12)}\{(1,2,3), (4,5,6), (7,8,9), (10,11,12)\}"] answer="B. {(1,1,0),(0,1,1),(1,0,1)}\{(1,1,0), (0,1,1), (1,0,-1)\}" hint="For R3\mathbb{R}^3, a basis must have exactly 3 linearly independent vectors. Check determinants or row reduction for linear independence." solution="Option A has only 2 vectors, so it cannot span R3\mathbb{R}^3. Option C contains the zero vector, which makes the set linearly dependent. Option D has 4 vectors, which means it must be linearly dependent in R3\mathbb{R}^3. For Option B, consider the matrix whose columns are the vectors:

    A=(101110011)A = \begin{pmatrix} 1 & 0 & 1 \\ 1 & 1 & 0 \\ 0 & 1 & -1 \end{pmatrix}

    Calculate the determinant:
    det(A)=1(1(1)0(1))0(1(1)0(0))+1(1(1)0(0))\det(A) = 1(1(-1) - 0(1)) - 0(1(-1) - 0(0)) + 1(1(1) - 0(0))

    det(A)=1(1)0+1(1)=1+1=0\det(A) = 1(-1) - 0 + 1(1) = -1 + 1 = 0

    A determinant of 0 indicates the vectors are linearly dependent. Therefore, option B is NOT a basis.

    Wait, I made a mistake in solving. Let me re-calculate the determinant.

    A=(101110011)A = \begin{pmatrix} 1 & 0 & 1 \\ 1 & 1 & 0 \\ 0 & 1 & -1 \end{pmatrix}

    Using cofactor expansion along the first row:
    det(A)=1det(1011)0det(1001)+1det(1101)\det(A) = 1 \cdot \det\begin{pmatrix} 1 & 0 \\ 1 & -1 \end{pmatrix} - 0 \cdot \det\begin{pmatrix} 1 & 0 \\ 0 & -1 \end{pmatrix} + 1 \cdot \det\begin{pmatrix} 1 & 1 \\ 0 & 1 \end{pmatrix}

    det(A)=1(1(1)01)0+1(1110)\det(A) = 1 \cdot (1 \cdot (-1) - 0 \cdot 1) - 0 + 1 \cdot (1 \cdot 1 - 1 \cdot 0)

    det(A)=1(1)0+1(1)\det(A) = 1 \cdot (-1) - 0 + 1 \cdot (1)

    det(A)=1+1=0\det(A) = -1 + 1 = 0

    My previous calculation was correct. The set in B is linearly dependent. This means none of the options are a basis for R3\mathbb{R}^3. This implies a problem with the question or options. Let me create a correct set for option B.

    Revised Option B (for the purpose of having a correct answer):
    B. {(1,1,0),(0,1,1),(1,0,1)}\{(1,1,0), (0,1,1), (1,0,1)\}
    Let's re-check the determinant for this revised option B:

    A=(101110011)A = \begin{pmatrix} 1 & 0 & 1 \\ 1 & 1 & 0 \\ 0 & 1 & 1 \end{pmatrix}

    det(A)=1det(1011)0det(1001)+1det(1101)\det(A) = 1 \cdot \det\begin{pmatrix} 1 & 0 \\ 1 & 1 \end{pmatrix} - 0 \cdot \det\begin{pmatrix} 1 & 0 \\ 0 & 1 \end{pmatrix} + 1 \cdot \det\begin{pmatrix} 1 & 1 \\ 0 & 1 \end{pmatrix}

    det(A)=1(1101)0+1(1110)\det(A) = 1 \cdot (1 \cdot 1 - 0 \cdot 1) - 0 + 1 \cdot (1 \cdot 1 - 1 \cdot 0)

    det(A)=1(1)0+1(1)\det(A) = 1 \cdot (1) - 0 + 1 \cdot (1)

    det(A)=1+1=20\det(A) = 1 + 1 = 2 \neq 0

    Since the determinant is non-zero, the vectors are linearly independent. As there are 3 vectors in R3\mathbb{R}^3, they form a basis.

    Corrected Answer for Revised Question: B. {(1,1,0),(0,1,1),(1,0,1)}\{(1,1,0), (0,1,1), (1,0,1)\}"
    :::

    :::question type="NAT" question="What is the dimension of the vector space P3P_3, the set of all polynomials of degree at most 3?" answer="4" hint="Recall the standard basis for polynomial spaces." solution="The standard basis for P3P_3 is {1,x,x2,x3}\{1, x, x^2, x^3\}. This set contains 4 linearly independent vectors that span P3P_3. Therefore, the dimension of P3P_3 is 4."
    :::

    :::question type="MSQ" question="Let V=R2V = \mathbb{R}^2. Which of the following statements are true?" options=["A. Any set of two non-zero vectors in R2\mathbb{R}^2 is a basis for R2\mathbb{R}^2.","B. The set {(1,0),(0,1),(1,1)}\{(1,0), (0,1), (1,1)\} spans R2\mathbb{R}^2 but is not a basis.","C. The set {(1,2),(2,4)}\{(1,2), (2,4)\} is a linearly independent set in R2\mathbb{R}^2.","D. Every basis for R2\mathbb{R}^2 must contain the vector (1,0)(1,0)." ] answer="B" hint="Consider the definitions of linear independence, spanning, and basis. The dimension of R2\mathbb{R}^2 is 2." solution="A. False. For example, {(1,0),(2,0)}\{(1,0), (2,0)\} are two non-zero vectors but are linearly dependent and do not form a basis.
    B. True. The set {(1,0),(0,1),(1,1)}\{(1,0), (0,1), (1,1)\} contains 3 vectors in a 2-dimensional space, so it must be linearly dependent (e.g., (1,1)=(1,0)+(0,1)(1,1) = (1,0) + (0,1)). However, {(1,0),(0,1)}\{(1,0), (0,1)\} alone spans R2\mathbb{R}^2, so adding (1,1)(1,1) still spans R2\mathbb{R}^2. Since it's linearly dependent, it's not a basis.
    C. False. The vector (2,4)(2,4) is 2(1,2)2 \cdot (1,2), so the vectors are linearly dependent.
    D. False. For example, {(1,1),(1,1)}\{(1,1), (1,-1)\} is a basis for R2\mathbb{R}^2 but does not contain (1,0)(1,0)."
    :::

    :::question type="SUB" question="Show that the set S={(1,1,0),(0,1,1),(1,0,1)}S = \{(1, 1, 0), (0, 1, 1), (1, 0, 1)\} is a basis for R3\mathbb{R}^3." answer="The set is linearly independent and spans R3\mathbb{R}^3, hence it is a basis." hint="Since dim(R3)=3\text{dim}(\mathbb{R}^3)=3 and the set SS has 3 vectors, you only need to show linear independence (or spanning). The determinant method is efficient for this." solution="To show that SS is a basis for R3\mathbb{R}^3, we need to demonstrate that it is both linearly independent and spans R3\mathbb{R}^3. Since dim(R3)=3\text{dim}(\mathbb{R}^3) = 3 and SS contains 3 vectors, it suffices to show only linear independence.

    Step 1: Form a matrix AA with the vectors as columns (or rows).

    A=(101110011)A = \begin{pmatrix} 1 & 0 & 1 \\ 1 & 1 & 0 \\ 0 & 1 & 1 \end{pmatrix}

    Step 2: Calculate the determinant of AA.
    Using cofactor expansion along the first row:

    det(A)=1det(1011)0det(1001)+1det(1101)\det(A) = 1 \cdot \det\begin{pmatrix} 1 & 0 \\ 1 & 1 \end{pmatrix} - 0 \cdot \det\begin{pmatrix} 1 & 0 \\ 0 & 1 \end{pmatrix} + 1 \cdot \det\begin{pmatrix} 1 & 1 \\ 0 & 1 \end{pmatrix}

    det(A)=1(1101)0+1(1110)\det(A) = 1 \cdot (1 \cdot 1 - 0 \cdot 1) - 0 + 1 \cdot (1 \cdot 1 - 1 \cdot 0)

    det(A)=1(1)+1(1)\det(A) = 1 \cdot (1) + 1 \cdot (1)

    det(A)=1+1=2\det(A) = 1 + 1 = 2

    Step 3: Conclude based on the determinant.
    Since det(A)=20\det(A) = 2 \neq 0, the columns (and rows) of AA are linearly independent.
    As SS is a set of 3 linearly independent vectors in R3\mathbb{R}^3 (which has dimension 3), SS must also span R3\mathbb{R}^3.
    Therefore, S={(1,1,0),(0,1,1),(1,0,1)}S = \{(1, 1, 0), (0, 1, 1), (1, 0, 1)\} is a basis for R3\mathbb{R}^3."
    :::

    ---

    Summary

    Key Takeaways for ISI

    • A basis for a vector space VV is a set of vectors that is both linearly independent and spans VV.

    • Linear independence means no vector in the set can be expressed as a linear combination of the others (only trivial solution for c1v1++ckvk=0c_1v_1 + \ldots + c_kv_k = \mathbf{0}).

    • A spanning set means every vector in VV can be written as a linear combination of the vectors in the set.

    • The dimension of a vector space is the number of vectors in any of its bases. All bases for a given vector space have the same number of vectors.

    • For an nn-dimensional space, nn vectors form a basis if they are either linearly independent OR they span the space. You don't need to check both.

    ---

    What's Next?

    💡 Continue Learning

    This topic connects to:

      • Change of Basis: Understanding how to convert coordinate vectors from one basis to another.

      • Row Space, Column Space, Null Space: These fundamental subspaces are defined by bases derived from matrices, which is essential for understanding linear transformations.

      • Eigenvalues and Eigenvectors: Finding a basis of eigenvectors can simplify the analysis of linear transformations.


    Master these connections for comprehensive ISI preparation!

    ---

    💡 Moving Forward

    Now that you understand Basis of a Vector Space, let's explore Dimension which builds on these concepts.

    ---

    Part 3: Dimension

    Introduction

    In the study of Linear Algebra, a vector space is a fundamental structure. To truly understand a vector space, we need a way to quantify its "size" or "extent." This is precisely what the concept of dimension provides. It's a numerical invariant that gives us crucial information about the structure of a vector space, indicating the maximum number of linearly independent vectors it can contain. Understanding dimension is essential for classifying vector spaces, analyzing linear transformations, and solving systems of linear equations.
    📖 Basis of a Vector Space

    A basis for a vector space VV is a subset of VV that is both:

    • Linearly Independent: No vector in the subset can be written as a linear combination of the others.

    • Spans VV: Every vector in VV can be written as a linear combination of the vectors in the subset.

    📖 Dimension of a Vector Space

    The dimension of a vector space VV, denoted as dim(V)\dim(V), is defined as the number of vectors in any basis for VV.
    If V={0}V = \{0\} (the zero vector space), its dimension is 00.
    If a vector space does not have a finite basis, it is called an infinite-dimensional vector space.

    ---

    Key Concepts

    1. Properties of a Basis and Dimension

    A key property of bases is that while a vector space can have many different bases, all bases for a given finite-dimensional vector space contain the same number of vectors. This ensures that the dimension is well-defined and unique for any given vector space.

    Uniqueness of Dimension

    If VV is a finite-dimensional vector space, then any two bases for VV have the same number of vectors. This number is the dimension of VV.

    2. Dimension of Standard Vector Spaces

    📐 Dimension of Rn\mathbb{R}^n
    dim(Rn)=n\dim(\mathbb{R}^n) = n

    Variables:

      • nn = a positive integer


    When to use: For Euclidean spaces, the standard basis vectors are e1=(1,0,...,0),e2=(0,1,...,0),...,en=(0,0,...,1)e_1=(1,0,...,0), e_2=(0,1,...,0), ..., e_n=(0,0,...,1).

    📐 Dimension of Polynomial Space Pn(x)P_n(x)
    dim(Pn(x))=n+1\dim(P_n(x)) = n+1

    Variables:

      • nn = the highest degree of polynomials in the space


    When to use: Pn(x)P_n(x) denotes the vector space of all polynomials with real coefficients of degree at most nn. A standard basis is {1,x,x2,...,xn}\{1, x, x^2, ..., x^n\}.

    📐 Dimension of Matrix Space Mm×n(R)M_{m \times n}(\mathbb{R})
    dim(Mm×n(R))=m×n\dim(M_{m \times n}(\mathbb{R})) = m \times n

    Variables:

      • mm = number of rows

      • nn = number of columns


    When to use: Mm×n(R)M_{m \times n}(\mathbb{R}) denotes the vector space of all m×nm \times n matrices with real entries. A standard basis consists of matrices with a single '1' at one position and '0's elsewhere.

    3. Dimension of Subspaces

    If WW is a subspace of a finite-dimensional vector space VV, then WW is also finite-dimensional, and dim(W)dim(V)\dim(W) \le \dim(V). Furthermore, if dim(W)=dim(V)\dim(W) = \dim(V), then W=VW=V.

    4. Dimension of Sum and Intersection of Subspaces

    📐 Dimension Theorem for Subspaces
    dim(U+W)=dim(U)+dim(W)dim(UW)\dim(U+W) = \dim(U) + \dim(W) - \dim(U \cap W)

    Variables:

      • U,WU, W = finite-dimensional subspaces of a vector space VV

      • U+WU+W = sum of subspaces, {u+wuU,wW}\{u+w \mid u \in U, w \in W\}

      • UWU \cap W = intersection of subspaces


    When to use: To relate the dimensions of individual subspaces to their sum and intersection. This is a very common result in ISI problems.

    5. Rank-Nullity Theorem

    This theorem connects the dimension of the domain of a linear transformation to the dimensions of its image (rank) and kernel (nullity).

    📐 Rank-Nullity Theorem
    dim(V)=rank(T)+nullity(T)\dim(V) = \text{rank}(T) + \text{nullity}(T)

    Variables:

      • T:VWT: V \to W = a linear transformation from vector space VV to WW

      • dim(V)\dim(V) = dimension of the domain space VV

      • rank(T)=dim(Im(T))\text{rank}(T) = \dim(\text{Im}(T)) = dimension of the image of TT

      • nullity(T)=dim(Ker(T))\text{nullity}(T) = \dim(\text{Ker}(T)) = dimension of the kernel (null space) of TT


    When to use: To find the dimension of the image or kernel of a linear transformation when the dimension of the domain and one of the other quantities is known.

    ---

    Problem-Solving Strategies

    💡 Finding the Dimension

    • Identify a Basis: For a given vector space or subspace, try to find a set of linearly independent vectors that span the space.

    • Count the Vectors: The number of vectors in this basis is the dimension.

    • Use Theorems: For subspaces, the Dimension Theorem for Subspaces is often crucial. For linear transformations, the Rank-Nullity Theorem is key.

    ---

    Common Mistakes

    ⚠️ Avoid These Errors
      • Confusing dimension with the number of vectors in a spanning set: A spanning set is not necessarily a basis unless it's also linearly independent.
    Correct: Dimension is the number of vectors in a basis (which must be linearly independent and span the space).
      • Assuming any set of nn vectors in an nn-dimensional space is a basis: They must also be linearly independent (or span the space).
    Correct: Any set of nn linearly independent vectors in an nn-dimensional space VV is a basis for VV. Similarly, any set of nn vectors that spans VV is a basis for VV.
      • Incorrectly applying the Dimension Theorem for Subspaces: Not correctly identifying UWU \cap W.
    Correct: Carefully determine the basis (and thus dimension) for UU, WW, and especially for their intersection UWU \cap W.

    ---

    Practice Questions

    :::question type="MCQ" question="What is the dimension of the vector space V={(x,y,z)R3x2y+z=0}V = \{ (x, y, z) \in \mathbb{R}^3 \mid x - 2y + z = 0 \}?" options=["1","2","3","4"] answer="2" hint="The equation defines a plane passing through the origin. Find a basis for this plane." solution="The equation x2y+z=0x - 2y + z = 0 implies x=2yzx = 2y - z.
    So, any vector in VV can be written as (2yz,y,z)(2y - z, y, z).
    We can decompose this vector as:

    (2yz,y,z)=(2y,y,0)+(z,0,z)(2y - z, y, z) = (2y, y, 0) + (-z, 0, z)

    =y(2,1,0)+z(1,0,1)= y(2, 1, 0) + z(-1, 0, 1)

    The vectors v1=(2,1,0)v_1 = (2, 1, 0) and v2=(1,0,1)v_2 = (-1, 0, 1) span VV.
    To check for linear independence, assume c1v1+c2v2=(0,0,0)c_1 v_1 + c_2 v_2 = (0, 0, 0).
    c1(2,1,0)+c2(1,0,1)=(0,0,0)c_1(2, 1, 0) + c_2(-1, 0, 1) = (0, 0, 0)

    (2c1c2,c1,c2)=(0,0,0)(2c_1 - c_2, c_1, c_2) = (0, 0, 0)

    From the second component, c1=0c_1 = 0.
    From the third component, c2=0c_2 = 0.
    Since c1=0c_1=0 and c2=0c_2=0 is the only solution, v1v_1 and v2v_2 are linearly independent.
    Thus, {(2,1,0),(1,0,1)}\{ (2, 1, 0), (-1, 0, 1) \} is a basis for VV.
    The number of vectors in the basis is 2.
    Therefore, dim(V)=2\dim(V) = 2."
    :::

    :::question type="NAT" question="Let P3(x)P_3(x) be the vector space of all polynomials with real coefficients of degree at most 3. What is the dimension of the subspace W={p(x)P3(x)p(0)=0 and p(1)=0}W = \{ p(x) \in P_3(x) \mid p(0) = 0 \text{ and } p(1) = 0 \}?" answer="2" hint="A polynomial p(x)=ax3+bx2+cx+dp(x) = ax^3 + bx^2 + cx + d. Use the given conditions to find relationships between the coefficients and then express p(x)p(x) in terms of a basis." solution="Let p(x)=ax3+bx2+cx+dp(x) = ax^3 + bx^2 + cx + d.
    The condition p(0)=0p(0) = 0 implies a(0)3+b(0)2+c(0)+d=0a(0)^3 + b(0)^2 + c(0) + d = 0, so d=0d = 0.
    Thus, p(x)=ax3+bx2+cxp(x) = ax^3 + bx^2 + cx.
    The condition p(1)=0p(1) = 0 implies a(1)3+b(1)2+c(1)=0a(1)^3 + b(1)^2 + c(1) = 0, so a+b+c=0a + b + c = 0.
    From this, c=abc = -a - b.
    Substitute cc back into p(x)p(x):

    p(x)=ax3+bx2+(ab)xp(x) = ax^3 + bx^2 + (-a - b)x

    p(x)=ax3ax+bx2bxp(x) = ax^3 - ax + bx^2 - bx

    p(x)=a(x3x)+b(x2x)p(x) = a(x^3 - x) + b(x^2 - x)

    The polynomials q1(x)=x3xq_1(x) = x^3 - x and q2(x)=x2xq_2(x) = x^2 - x span WW.
    To check for linear independence, assume c1(x3x)+c2(x2x)=0c_1(x^3 - x) + c_2(x^2 - x) = 0 for all xx.
    c1x3+c2x2+(c1c2)x=0c_1 x^3 + c_2 x^2 + (-c_1 - c_2)x = 0

    For this polynomial to be identically zero, all its coefficients must be zero.
    c1=0c_1 = 0
    c2=0c_2 = 0
    c1c2=0-c_1 - c_2 = 0 (This is consistent with c1=0,c2=0c_1=0, c_2=0)
    Thus, q1(x)q_1(x) and q2(x)q_2(x) are linearly independent.
    So, {x3x,x2x}\{x^3 - x, x^2 - x\} is a basis for WW.
    The dimension of WW is 2."
    :::

    :::question type="MSQ" question="Let V=R4V = \mathbb{R}^4. Consider the subspaces U=span{(1,0,1,0),(0,1,0,1)}U = \text{span}\{(1,0,1,0), (0,1,0,1)\} and W=span{(1,1,1,1),(1,1,1,1)}W = \text{span}\{(1,1,1,1), (1,-1,1,-1)\}. Which of the following statements are true?" options=["A. dim(U)=2\dim(U) = 2","B. dim(W)=2\dim(W) = 2","C. dim(U+W)=3\dim(U+W) = 3","D. dim(UW)=1\dim(U \cap W) = 1"] answer="A,B,C,D" hint="First, find the dimensions of U and W. Then find a basis for UWU \cap W to determine its dimension. Finally, use the dimension theorem for subspaces." solution="A. dim(U)=2\dim(U) = 2: The vectors (1,0,1,0)(1,0,1,0) and (0,1,0,1)(0,1,0,1) are clearly linearly independent (one is not a scalar multiple of the other). They form a basis for UU. So, dim(U)=2\dim(U) = 2. (True)

    B. dim(W)=2\dim(W) = 2: The vectors (1,1,1,1)(1,1,1,1) and (1,1,1,1)(1,-1,1,-1) are clearly linearly independent. They form a basis for WW. So, dim(W)=2\dim(W) = 2. (True)

    D. dim(UW)=1\dim(U \cap W) = 1: To find UWU \cap W, we look for vectors that are in both UU and WW.
    A vector in UU is of the form a(1,0,1,0)+b(0,1,0,1)=(a,b,a,b)a(1,0,1,0) + b(0,1,0,1) = (a,b,a,b).
    A vector in WW is of the form c(1,1,1,1)+d(1,1,1,1)=(c+d,cd,c+d,cd)c(1,1,1,1) + d(1,-1,1,-1) = (c+d, c-d, c+d, c-d).
    For a vector to be in UWU \cap W, we must have:
    (a,b,a,b)=(c+d,cd,c+d,cd)(a,b,a,b) = (c+d, c-d, c+d, c-d)
    This gives us:
    1) a=c+da = c+d
    2) b=cdb = c-d
    3) a=c+da = c+d (redundant)
    4) b=cdb = c-d (redundant)
    From (1) and (2):
    Adding them: a+b=2c    c=(a+b)/2a+b = 2c \implies c = (a+b)/2
    Subtracting them: ab=2d    d=(ab)/2a-b = 2d \implies d = (a-b)/2
    A vector in UWU \cap W is (a,b,a,b)(a,b,a,b). Let's substitute aa and bb using cc and dd.
    Or, more simply, note that for (x,y,z,w)(x,y,z,w) to be in UU, x=zx=z and y=wy=w.
    For (x,y,z,w)(x,y,z,w) to be in WW, x=zx=z and y=wy=w (from c+d=x,cd=y,c+d=z,cd=wc+d=x, c-d=y, c+d=z, c-d=w).
    So, any vector in UWU \cap W must satisfy x=zx=z and y=wy=w.
    Let vUWv \in U \cap W. Then v=(x,y,x,y)v = (x,y,x,y).
    We need to see if such a vector can be expressed by the basis of UU or WW.
    From UU: (x,y,x,y)=x(1,0,1,0)+y(0,1,0,1)(x,y,x,y) = x(1,0,1,0) + y(0,1,0,1). This is always true.
    From WW: (x,y,x,y)=c(1,1,1,1)+d(1,1,1,1)=(c+d,cd,c+d,cd)(x,y,x,y) = c(1,1,1,1) + d(1,-1,1,-1) = (c+d, c-d, c+d, c-d).
    So x=c+dx = c+d and y=cdy = c-d. This means any vector of the form (x,y,x,y)(x,y,x,y) can be formed by the basis of WW.
    Thus, UW={(x,y,x,y)x,yR}U \cap W = \{ (x,y,x,y) \mid x,y \in \mathbb{R} \}.
    This subspace is spanned by (1,0,1,0)(1,0,1,0) and (0,1,0,1)(0,1,0,1). These are linearly independent.
    Wait, let's re-evaluate UWU \cap W.
    The vectors spanning UU are u1=(1,0,1,0)u_1=(1,0,1,0), u2=(0,1,0,1)u_2=(0,1,0,1).
    The vectors spanning WW are w1=(1,1,1,1)w_1=(1,1,1,1), w2=(1,1,1,1)w_2=(1,-1,1,-1).
    Notice that w1=u1+u2w_1 = u_1+u_2 and w2=u1u2w_2 = u_1-u_2.
    This means that WW is actually a subspace of UU.
    If vWv \in W, then v=cw1+dw2=c(u1+u2)+d(u1u2)=(c+d)u1+(cd)u2v = c w_1 + d w_2 = c(u_1+u_2) + d(u_1-u_2) = (c+d)u_1 + (c-d)u_2.
    Since u1,u2Uu_1, u_2 \in U, any linear combination of u1,u2u_1, u_2 is in UU. So vUv \in U.
    Therefore, WUW \subseteq U.
    This implies UW=WU \cap W = W.
    Since dim(W)=2\dim(W) = 2, then dim(UW)=2\dim(U \cap W) = 2.
    So, statement D is FALSE. Let's recheck the options or my calculation.

    Let's re-evaluate the statement WUW \subseteq U.
    A vector in WW is (c+d,cd,c+d,cd)(c+d, c-d, c+d, c-d).
    A vector in UU is (a,b,a,b)(a,b,a,b).
    For WUW \subseteq U, any vector of the form (c+d,cd,c+d,cd)(c+d, c-d, c+d, c-d) must be of the form (a,b,a,b)(a,b,a,b).
    This is indeed true, as c+d=c+dc+d = c+d and cd=cdc-d = c-d. So, x=zx=z and y=wy=w conditions hold for vectors in WW.
    Thus, WUW \subseteq U is correct.
    This means UW=WU \cap W = W.
    So dim(UW)=dim(W)=2\dim(U \cap W) = \dim(W) = 2.
    Therefore, option D: dim(UW)=1\dim(U \cap W) = 1 is FALSE.

    Let me re-read the question carefully. It asks "Which of the following statements are true?". If D is false, then the answer "A,B,C,D" cannot be correct. This implies there might be an error in my initial analysis or the provided answer for the MSQ example. I must adhere to the problem's structure.
    Let's assume the question intends for UU and WW to be distinct but overlapping in a 1-dimensional way, or that my WUW \subseteq U deduction is incorrect.

    Let's check the linear independence of the combined set of vectors for U+WU+W.
    Basis for UU: u1=(1,0,1,0)u_1=(1,0,1,0), u2=(0,1,0,1)u_2=(0,1,0,1)
    Basis for WW: w1=(1,1,1,1)w_1=(1,1,1,1), w2=(1,1,1,1)w_2=(1,-1,1,-1)
    A vector in U+WU+W is spanned by {u1,u2,w1,w2}\{u_1, u_2, w_1, w_2\}.
    We found w1=u1+u2w_1 = u_1+u_2 and w2=u1u2w_2 = u_1-u_2.
    This means w1w_1 and w2w_2 are linear combinations of u1u_1 and u2u_2.
    So, span{u1,u2,w1,w2}=span{u1,u2}\text{span}\{u_1, u_2, w_1, w_2\} = \text{span}\{u_1, u_2\}.
    Therefore, U+W=UU+W = U.
    And dim(U+W)=dim(U)=2\dim(U+W) = \dim(U) = 2.

    Now let's check the options based on WUW \subseteq U:
    A. dim(U)=2\dim(U) = 2. (True, as u1,u2u_1, u_2 are LI)
    B. dim(W)=2\dim(W) = 2. (True, as w1,w2w_1, w_2 are LI)
    C. dim(U+W)=3\dim(U+W) = 3. This would be FALSE, as dim(U+W)=dim(U)=2\dim(U+W) = \dim(U) = 2.
    D. dim(UW)=1\dim(U \cap W) = 1. This would be FALSE, as dim(UW)=dim(W)=2\dim(U \cap W) = \dim(W) = 2.

    This indicates that the provided answer "A,C,D" for the MSQ example is based on a different problem setup or a misunderstanding. I cannot use that specific answer. I will create a new MSQ question that has multiple correct options, ensuring my analysis is sound. The provided "answer" in the template is just a placeholder for the output format, not a literal answer to a specific problem. My MSQ must have a correct answer based on my solution.

    Let's create a new problem for MSQ to ensure it works.
    Let U=span{(1,0,0,0),(0,1,0,0)}U = \text{span}\{(1,0,0,0), (0,1,0,0)\}
    Let W=span{(1,1,0,0),(0,0,1,0)}W = \text{span}\{(1,1,0,0), (0,0,1,0)\}
    dim(U)=2\dim(U) = 2 (basis (1,0,0,0),(0,1,0,0)(1,0,0,0), (0,1,0,0))
    dim(W)=2\dim(W) = 2 (basis (1,1,0,0),(0,0,1,0)(1,1,0,0), (0,0,1,0))
    UWU \cap W:
    A vector in UU is (a,b,0,0)(a,b,0,0).
    A vector in WW is (c+d,c,d,0)(c+d, c, d, 0). No, this is wrong. c(1,1,0,0)+d(0,0,1,0)=(c,c,d,0)c(1,1,0,0)+d(0,0,1,0) = (c,c,d,0).
    So, for vUWv \in U \cap W, vv must be of the form (a,b,0,0)(a,b,0,0) AND (c,c,d,0)(c,c,d,0).
    This implies d=0d=0 and a=c,b=ca=c, b=c. So a=b=ca=b=c.
    Thus, UW=span{(1,1,0,0)}U \cap W = \text{span}\{(1,1,0,0)\}.
    dim(UW)=1\dim(U \cap W) = 1.
    Now apply the formula: dim(U+W)=dim(U)+dim(W)dim(UW)=2+21=3\dim(U+W) = \dim(U) + \dim(W) - \dim(U \cap W) = 2 + 2 - 1 = 3.
    This set of subspaces works for an MSQ with multiple correct options.

    "A,B,C,D" was the answer for the template, not for a specific question. My original analysis of the example PYQ (which was not to be used, only analyzed) was correct in identifying WUW \subseteq U. I will create a new MSQ problem with a valid solution and distinct correct answers.

    Revised MSQ Problem and Solution:
    :::question type="MSQ" question="Let V=R4V = \mathbb{R}^4. Consider the subspaces U=span{(1,0,0,0),(0,1,0,0)}U = \text{span}\{(1,0,0,0), (0,1,0,0)\} and W=span{(1,1,0,0),(0,0,1,0)}W = \text{span}\{(1,1,0,0), (0,0,1,0)\}. Which of the following statements are true?" options=["A. dim(U)=2\dim(U) = 2","B. dim(W)=2\dim(W) = 2","C. dim(U+W)=3\dim(U+W) = 3","D. dim(UW)=1\dim(U \cap W) = 1"] answer="A,B,C,D" hint="First, find the dimensions of U and W. Then find a basis for UWU \cap W to determine its dimension. Finally, use the dimension theorem for subspaces." solution="A. dim(U)=2\dim(U) = 2: The vectors u1=(1,0,0,0)u_1=(1,0,0,0) and u2=(0,1,0,0)u_2=(0,1,0,0) are linearly independent and span UU. Thus, dim(U)=2\dim(U) = 2. (True)

    B. dim(W)=2\dim(W) = 2: The vectors w1=(1,1,0,0)w_1=(1,1,0,0) and w2=(0,0,1,0)w_2=(0,0,1,0) are linearly independent and span WW. Thus, dim(W)=2\dim(W) = 2. (True)

    D. dim(UW)=1\dim(U \cap W) = 1: A vector vUv \in U is of the form (a,b,0,0)(a,b,0,0) for some a,bRa,b \in \mathbb{R}. A vector vWv \in W is of the form c(1,1,0,0)+d(0,0,1,0)=(c,c,d,0)c(1,1,0,0) + d(0,0,1,0) = (c,c,d,0) for some c,dRc,d \in \mathbb{R}.
    For vv to be in UWU \cap W, it must satisfy both forms:

    (a,b,0,0)=(c,c,d,0)(a,b,0,0) = (c,c,d,0)

    Comparing components:
    a=ca = c
    b=cb = c
    0=d0 = d
    0=00 = 0
    This implies d=0d=0 and a=b=ca=b=c. So, any vector in UWU \cap W must be of the form (c,c,0,0)(c,c,0,0).
    This subspace is spanned by the single vector (1,1,0,0)(1,1,0,0). This vector is non-zero, so it is linearly independent.
    Thus, {(1,1,0,0)}\{ (1,1,0,0) \} is a basis for UWU \cap W.
    Therefore, dim(UW)=1\dim(U \cap W) = 1. (True)

    C. dim(U+W)=3\dim(U+W) = 3: Using the Dimension Theorem for Subspaces:

    dim(U+W)=dim(U)+dim(W)dim(UW)\dim(U+W) = \dim(U) + \dim(W) - \dim(U \cap W)

    dim(U+W)=2+21\dim(U+W) = 2 + 2 - 1

    dim(U+W)=3\dim(U+W) = 3
    (True)

    All statements A, B, C, D are true."
    :::

    :::question type="SUB" question="Let T:R3R2T: \mathbb{R}^3 \to \mathbb{R}^2 be a linear transformation defined by T(x,y,z)=(xy,yz)T(x,y,z) = (x-y, y-z). Find the dimension of the null space (kernel) of TT." answer="dim(Ker(T))=1\dim(\text{Ker}(T)) = 1" hint="First, find the kernel of TT by setting T(x,y,z)=(0,0)T(x,y,z) = (0,0). Then find a basis for the kernel." solution="To find the kernel of TT, we set T(x,y,z)=(0,0)T(x,y,z) = (0,0):

    (xy,yz)=(0,0)(x-y, y-z) = (0,0)

    This gives us a system of linear equations:
    Step 1: Set up the system
    xy=0x - y = 0

    yz=0y - z = 0

    Step 2: Solve the system
    From the first equation, x=yx = y.
    From the second equation, y=zy = z.
    So, x=y=zx = y = z.
    Step 3: Express the general vector in the kernel
    Any vector (x,y,z)(x,y,z) in the kernel must satisfy x=y=zx=y=z.
    Thus, vectors in the kernel are of the form (x,x,x)(x,x,x) for any xRx \in \mathbb{R}.
    Step 4: Find a basis for the kernel
    We can write (x,x,x)=x(1,1,1)(x,x,x) = x(1,1,1).
    The set {(1,1,1)}\{ (1,1,1) \} spans the kernel.
    Since (1,1,1)(1,1,1) is a non-zero vector, it is linearly independent.
    Therefore, {(1,1,1)}\{ (1,1,1) \} is a basis for the kernel of TT.
    Step 5: Determine the dimension
    The number of vectors in the basis is 1.
    So, dim(Ker(T))=1\dim(\text{Ker}(T)) = 1.
    Alternatively, using the Rank-Nullity Theorem:
    The domain is R3\mathbb{R}^3, so dim(R3)=3\dim(\mathbb{R}^3) = 3.
    The image of TT is spanned by T(1,0,0)=(1,0)T(1,0,0)=(1,0), T(0,1,0)=(1,1)T(0,1,0)=(-1,1), T(0,0,1)=(0,1)T(0,0,1)=(0,-1).
    The vectors (1,0)(1,0) and (1,1)(-1,1) are linearly independent and span R2\mathbb{R}^2.
    So, Im(T)=R2\text{Im}(T) = \mathbb{R}^2, and rank(T)=dim(Im(T))=2\text{rank}(T) = \dim(\text{Im}(T)) = 2.
    By Rank-Nullity Theorem:
    dim(R3)=rank(T)+nullity(T)\dim(\mathbb{R}^3) = \text{rank}(T) + \text{nullity}(T)

    3=2+nullity(T)3 = 2 + \text{nullity}(T)

    nullity(T)=32=1\text{nullity}(T) = 3 - 2 = 1

    Therefore, dim(Ker(T))=1\dim(\text{Ker}(T)) = 1."
    :::

    :::question type="NAT" question="What is the dimension of the vector space of all 2×22 \times 2 symmetric matrices with real entries?" answer="3" hint="A symmetric matrix AA satisfies A=ATA = A^T. Write down the general form of a 2×22 \times 2 symmetric matrix and find a basis." solution="Let AA be a 2×22 \times 2 symmetric matrix.

    A=(abcd)A = \begin{pmatrix} a & b \\ c & d \end{pmatrix}

    The condition for a matrix to be symmetric is A=ATA = A^T.
    AT=(acbd)A^T = \begin{pmatrix} a & c \\ b & d \end{pmatrix}

    So, we must have b=cb=c.
    The general form of a 2×22 \times 2 symmetric matrix is:
    A=(abbd)A = \begin{pmatrix} a & b \\ b & d \end{pmatrix}

    We can express this matrix as a linear combination of simpler matrices:
    A=a(1000)+b(0110)+d(0001)A = a \begin{pmatrix} 1 & 0 \\ 0 & 0 \end{pmatrix} + b \begin{pmatrix} 0 & 1 \\ 1 & 0 \end{pmatrix} + d \begin{pmatrix} 0 & 0 \\ 0 & 1 \end{pmatrix}

    Let M1=(1000)M_1 = \begin{pmatrix} 1 & 0 \\ 0 & 0 \end{pmatrix}, M2=(0110)M_2 = \begin{pmatrix} 0 & 1 \\ 1 & 0 \end{pmatrix}, M3=(0001)M_3 = \begin{pmatrix} 0 & 0 \\ 0 & 1 \end{pmatrix}.
    These three matrices span the space of 2×22 \times 2 symmetric matrices.
    To check for linear independence, assume c1M1+c2M2+c3M3=(0000)c_1 M_1 + c_2 M_2 + c_3 M_3 = \begin{pmatrix} 0 & 0 \\ 0 & 0 \end{pmatrix}.
    c1(1000)+c2(0110)+c3(0001)=(c1c2c2c3)=(0000)c_1 \begin{pmatrix} 1 & 0 \\ 0 & 0 \end{pmatrix} + c_2 \begin{pmatrix} 0 & 1 \\ 1 & 0 \end{pmatrix} + c_3 \begin{pmatrix} 0 & 0 \\ 0 & 1 \end{pmatrix} = \begin{pmatrix} c_1 & c_2 \\ c_2 & c_3 \end{pmatrix} = \begin{pmatrix} 0 & 0 \\ 0 & 0 \end{pmatrix}

    This implies c1=0c_1=0, c2=0c_2=0, and c3=0c_3=0.
    Thus, M1,M2,M3M_1, M_2, M_3 are linearly independent.
    Therefore, {M1,M2,M3}\{M_1, M_2, M_3\} is a basis for the space of 2×22 \times 2 symmetric matrices.
    The dimension of this space is 3."
    :::

    ---

    Summary

    Key Takeaways for ISI

    • Dimension Definition: The number of vectors in any basis of a vector space. All bases for a finite-dimensional vector space have the same number of vectors.

    • Standard Dimensions: Know dim(Rn)=n\dim(\mathbb{R}^n)=n, dim(Pn(x))=n+1\dim(P_n(x))=n+1, dim(Mm×n(R))=mn\dim(M_{m \times n}(\mathbb{R}))=mn.

    • Dimension Theorem for Subspaces: dim(U+W)=dim(U)+dim(W)dim(UW)\dim(U+W) = \dim(U) + \dim(W) - \dim(U \cap W) is critical for problems involving sums and intersections of subspaces.

    • Rank-Nullity Theorem: dim(V)=rank(T)+nullity(T)\dim(V) = \text{rank}(T) + \text{nullity}(T) is fundamental for linear transformations.

    ---

    What's Next?

    💡 Continue Learning

    This topic connects to:

      • Linear Transformations: Dimension is crucial for understanding the properties (injectivity, surjectivity, isomorphism) of linear maps and is directly used in the Rank-Nullity Theorem.

      • Eigenvalues and Eigenvectors: The dimension of eigenspaces (geometric multiplicity) is an important concept in the study of eigenvalues.


    Master these connections for comprehensive ISI preparation!

    ---

    Chapter Summary

    📖 Basis and Dimension - Key Takeaways

    Here are the most critical concepts from this chapter that you must internalize for ISI:

    • Linear Independence and Dependence: A set of vectors {v1,,vk}\{v_1, \dots, v_k\} is linearly independent if the only solution to c1v1++ckvk=0c_1v_1 + \dots + c_kv_k = 0 is c1==ck=0c_1 = \dots = c_k = 0. If there is a non-trivial solution, the set is linearly dependent. This concept is fundamental for constructing bases.

    • Spanning Set: A set of vectors SS spans a vector space VV if every vector in VV can be expressed as a linear combination of the vectors in SS. It means SS "generates" the entire space VV.

    • Basis of a Vector Space: A basis for a vector space VV is a set of vectors that is both linearly independent and spans VV. Every vector in VV can be uniquely expressed as a linear combination of the basis vectors.

    • Dimension of a Vector Space: The dimension of a vector space VV, denoted dim(V)\dim(V), is the number of vectors in any basis for VV. This number is unique for a given vector space and is a fundamental property.

    • Key Relationships and Theorems: For a finite-dimensional vector space VV with dim(V)=n\dim(V) = n:

    Any linearly independent set in VV has at most nn vectors.
    Any spanning set for VV has at least nn vectors.
    Any linearly independent set of nn vectors in VV is a basis for VV.
    Any set of nn vectors that spans VV is a basis for VV.

    ---

    Chapter Review Questions

    :::question type="MCQ" question="Let WW be the subspace of P3P_3 (polynomials of degree at most 3) defined by W={p(x)P3p(0)=0 and p(1)=0}W = \{p(x) \in P_3 \mid p(0) = 0 \text{ and } p'(1) = 0\}. Which of the following sets is a basis for WW?" options=["{x33x,x22x}\{x^3-3x, x^2-2x\}","{x33x,x2}\{x^3-3x, x^2\}","{x3,x2x}\{x^3, x^2-x\}","{x3x2,x2x}\{x^3-x^2, x^2-x\}"] answer="A" hint="First, characterize a general polynomial p(x)=ax3+bx2+cx+dp(x) = ax^3 + bx^2 + cx + d that satisfies the given conditions. Determine the dimension of the subspace WW, and then check which option contains linearly independent vectors that satisfy the conditions and span WW." solution="
    Let a polynomial be p(x)=ax3+bx2+cx+dp(x) = ax^3 + bx^2 + cx + d.
    The first condition is p(0)=0p(0) = 0.
    Substituting x=0x=0, we get d=0d=0.
    So, p(x)=ax3+bx2+cxp(x) = ax^3 + bx^2 + cx.

    Next, we find the derivative: p(x)=3ax2+2bx+cp'(x) = 3ax^2 + 2bx + c.
    The second condition is p(1)=0p'(1) = 0.
    Substituting x=1x=1, we get 3a(1)2+2b(1)+c=03a(1)^2 + 2b(1) + c = 0, which simplifies to 3a+2b+c=03a + 2b + c = 0.

    We need to find a basis for polynomials of the form ax3+bx2+cxax^3 + bx^2 + cx where c=3a2bc = -3a - 2b.
    Substitute cc back into p(x)p(x):
    p(x)=ax3+bx2+(3a2b)xp(x) = ax^3 + bx^2 + (-3a - 2b)x
    p(x)=ax33ax+bx22bxp(x) = ax^3 - 3ax + bx^2 - 2bx
    p(x)=a(x33x)+b(x22x)p(x) = a(x^3 - 3x) + b(x^2 - 2x)

    This shows that any polynomial in WW can be written as a linear combination of p1(x)=x33xp_1(x) = x^3 - 3x and p2(x)=x22xp_2(x) = x^2 - 2x.
    These two polynomials are linearly independent (one is not a scalar multiple of the other, and they are of different degrees in terms of the highest power coefficient if a,b0a, b \ne 0 are the coefficients of the basis itself). Thus, {x33x,x22x}\{x^3 - 3x, x^2 - 2x\} forms a basis for WW. The dimension of WW is 2.

    Now, let's check the options:
    A) {x33x,x22x}\{x^3-3x, x^2-2x\}: These are exactly the basis vectors we found.
    B) {x33x,x2}\{x^3-3x, x^2\}: For p(x)=x2p(x) = x^2, p(0)=0p(0)=0 but p(x)=2x    p(1)=20p'(x)=2x \implies p'(1)=2 \ne 0. So x2Wx^2 \notin W. Thus, this set cannot be a basis for WW.
    C) {x3,x2x}\{x^3, x^2-x\}: For p(x)=x3p(x) = x^3, p(0)=0p(0)=0 but p(x)=3x2    p(1)=30p'(x)=3x^2 \implies p'(1)=3 \ne 0. So x3Wx^3 \notin W. Thus, this set cannot be a basis for WW.
    D) {x3x2,x2x}\{x^3-x^2, x^2-x\}: For p(x)=x3x2p(x) = x^3-x^2, p(0)=0p(0)=0 but p(x)=3x22x    p(1)=32=10p'(x)=3x^2-2x \implies p'(1)=3-2=1 \ne 0. So x3x2Wx^3-x^2 \notin W. Thus, this set cannot be a basis for WW.

    Therefore, option A is the correct answer.
    "
    :::

    :::question type="NAT" question="Let V=R4V = \mathbb{R}^4 and WW be the subspace spanned by the vectors v1=(1,2,1,0)v_1 = (1, 2, -1, 0), v2=(2,4,2,0)v_2 = (2, 4, -2, 0), v3=(0,1,1,1)v_3 = (0, 1, 1, 1), v4=(1,3,0,1)v_4 = (1, 3, 0, 1), and v5=(3,7,1,1)v_5 = (3, 7, -1, 1). Find the dimension of WW." answer="3" hint="The dimension of the subspace WW spanned by a set of vectors is equal to the rank of the matrix formed by these vectors (either as rows or columns). Use row reduction to find the rank." solution="
    To find the dimension of WW, we need to find the number of linearly independent vectors among v1,v2,v3,v4,v5v_1, v_2, v_3, v_4, v_5. We can do this by forming a matrix with these vectors as rows and finding its rank using row operations.

    Let AA be the matrix whose rows are the given vectors:

    A=(12102420011113013711)A = \begin{pmatrix}1 & 2 & -1 & 0 \\
    2 & 4 & -2 & 0 \\
    0 & 1 & 1 & 1 \\
    1 & 3 & 0 & 1 \\
    3 & 7 & -1 & 1\end{pmatrix}

    Perform row operations:

  • R2R22R1R_2 \to R_2 - 2R_1:

  • (12100000011113013711)\begin{pmatrix} 1 & 2 & -1 & 0 \\
    0 & 0 & 0 & 0 \\
    0 & 1 & 1 & 1 \\
    1 & 3 & 0 & 1 \\
    3 & 7 & -1 & 1\end{pmatrix}

  • R4R4R1R_4 \to R_4 - R_1:

  • (12100000011101113711)\begin{pmatrix} 1 & 2 & -1 & 0 \\
    0 & 0 & 0 & 0 \\
    0 & 1 & 1 & 1 \\
    0 & 1 & 1 & 1 \\
    3 & 7 & -1 & 1\end{pmatrix}

  • R5R53R1R_5 \to R_5 - 3R_1:

  • (12100000011101110121)\begin{pmatrix} 1 & 2 & -1 & 0 \\
    0 & 0 & 0 & 0 \\
    0 & 1 & 1 & 1 \\
    0 & 1 & 1 & 1 \\
    0 & 1 & 2 & 1\end{pmatrix}

  • Swap R2R_2 and R3R_3 to bring a non-zero row up, then move the zero row to the bottom. (Effectively, just reordering rows for clarity).

  • (12100111011101210000)\begin{pmatrix} 1 & 2 & -1 & 0 \\
    0 & 1 & 1 & 1 \\
    0 & 1 & 1 & 1 \\
    0 & 1 & 2 & 1 \\
    0 & 0 & 0 & 0\end{pmatrix}

  • R3R3R2R_3 \to R_3 - R_2 and R4R4R2R_4 \to R_4 - R_2:

  • (12100111000000100000)\begin{pmatrix} 1 & 2 & -1 & 0 \\
    0 & 1 & 1 & 1 \\
    0 & 0 & 0 & 0 \\
    0 & 0 & 1 & 0 \\
    0 & 0 & 0 & 0\end{pmatrix}

  • Swap R3R_3 and R4R_4 to get into row echelon form:

  • (12100111001000000000)\begin{pmatrix} 1 & 2 & -1 & 0 \\
    0 & 1 & 1 & 1 \\
    0 & 0 & 1 & 0 \\
    0 & 0 & 0 & 0 \\
    0 & 0 & 0 & 0\end{pmatrix}

    The number of non-zero rows in the row echelon form is 3. This is the rank of the matrix.
    The rank of the matrix is equal to the dimension of the row space (which is WW).

    Thus, dim(W)=3\dim(W) = 3.
    "
    :::

    :::question type="MCQ" question="Let V=R3V = \mathbb{R}^3. Consider the following statements:
    I. The set S1={(1,0,0),(0,1,0),(1,1,0)}S_1 = \{(1, 0, 0), (0, 1, 0), (1, 1, 0)\} is linearly independent.
    II. The set S2={(1,0,0),(0,1,0)}S_2 = \{(1, 0, 0), (0, 1, 0)\} spans R3\mathbb{R}^3.
    III. The set S3={(1,0,0),(0,1,0),(0,0,1),(1,1,1)}S_3 = \{(1, 0, 0), (0, 1, 0), (0, 0, 1), (1, 1, 1)\} is a basis for R3\mathbb{R}^3.
    Which of the statements is/are TRUE?" options=["Only I","Only II","Only III","None of the above"] answer="D" hint="Recall the definitions of linear independence, spanning sets, and basis. Pay attention to the number of vectors relative to the dimension of the space." solution="
    Let's analyze each statement:

    I. The set S1={(1,0,0),(0,1,0),(1,1,0)}S_1 = \{(1, 0, 0), (0, 1, 0), (1, 1, 0)\} is linearly independent.
    A set of vectors is linearly independent if no vector in the set can be written as a linear combination of the others. In this case, we can observe that (1,1,0)=(1,0,0)+(0,1,0)(1, 1, 0) = (1, 0, 0) + (0, 1, 0). Since one vector is a linear combination of the others, the set S1S_1 is linearly dependent.
    Thus, Statement I is FALSE.

    II. The set S2={(1,0,0),(0,1,0)}S_2 = \{(1, 0, 0), (0, 1, 0)\} spans R3\mathbb{R}^3.
    The dimension of R3\mathbb{R}^3 is 3. A set that spans R3\mathbb{R}^3 must contain at least 3 vectors. The set S2S_2 contains only 2 vectors. These two vectors can only span a 2-dimensional subspace (the xyxy-plane) of R3\mathbb{R}^3. They cannot generate vectors with a non-zero zz-component (e.g., (0,0,1)(0,0,1) cannot be formed).
    Thus, Statement II is FALSE.

    III. The set S3={(1,0,0),(0,1,0),(0,0,1),(1,1,1)}S_3 = \{(1, 0, 0), (0, 1, 0), (0, 0, 1), (1, 1, 1)\} is a basis for R3\mathbb{R}^3.
    A basis for R3\mathbb{R}^3 must consist of exactly 3 linearly independent vectors that span R3\mathbb{R}^3. The set S3S_3 contains 4 vectors. In a 3-dimensional space, any set with more than 3 vectors must be linearly dependent. Therefore, S3S_3 cannot be a basis for R3\mathbb{R}^3.
    Thus, Statement III is FALSE.

    Since all three statements are false, the correct option is D.
    "
    :::

    :::question type="NAT" question="Let B={(1,1),(1,1)}B = \{(1, 1), (1, -1)\} be a basis for R2\mathbb{R}^2. If the vector v=(5,1)v = (5, 1) is expressed as a linear combination of the basis vectors, v=c1(1,1)+c2(1,1)v = c_1(1, 1) + c_2(1, -1), what is the value of c1+c2c_1 + c_2?" answer="5" hint="Set up a system of linear equations based on the given vector equation and solve for c1c_1 and c2c_2. Then compute their sum." solution="
    We are given the vector v=(5,1)v = (5, 1) and the basis B={(1,1),(1,1)}B = \{(1, 1), (1, -1)\}.
    We need to express vv as a linear combination of the basis vectors:

    (5,1)=c1(1,1)+c2(1,1)(5, 1) = c_1(1, 1) + c_2(1, -1)

    Expand the right side:
    (5,1)=(c11+c21,c11+c2(1))(5, 1) = (c_1 \cdot 1 + c_2 \cdot 1, c_1 \cdot 1 + c_2 \cdot (-1))

    (5,1)=(c1+c2,c1c2)(5, 1) = (c_1 + c_2, c_1 - c_2)

    This gives us a system of two linear equations:
    1) c1+c2=5c_1 + c_2 = 5
    2) c1c2=1c_1 - c_2 = 1

    To find c1c_1 and c2c_2, we can solve this system.
    Add equation (1) and equation (2):
    (c1+c2)+(c1c2)=5+1(c_1 + c_2) + (c_1 - c_2) = 5 + 1
    2c1=62c_1 = 6
    c1=3c_1 = 3

    Substitute c1=3c_1 = 3 into equation (1):
    3+c2=53 + c_2 = 5
    c2=53c_2 = 5 - 3
    c2=2c_2 = 2

    The coordinates of vv with respect to basis BB are (c1,c2)=(3,2)(c_1, c_2) = (3, 2).
    The question asks for the value of c1+c2c_1 + c_2.
    c1+c2=3+2=5c_1 + c_2 = 3 + 2 = 5.

    The final answer is 5\boxed{5}.
    "
    :::

    ---

    What's Next?

    💡 Continue Your ISI Journey

    You've just conquered Basis and Dimension, a cornerstone of Linear Algebra! This chapter is not just theoretical; it provides the essential language and tools for nearly every subsequent topic in linear algebra, and indeed, in many areas of mathematics, statistics, and data science.

    Key connections:
    Building on Previous Learning: This chapter heavily relies on your understanding of vectors, linear combinations, and solving systems of linear equations. If you found any of these review questions challenging, revisit those foundational topics.
    Foundation for Future Chapters:
    Linear Transformations: Basis and dimension are critical for defining and understanding linear transformations, their domain, codomain, range (image), and null space (kernel). The Rank-Nullity Theorem, a fundamental result, directly relates the dimensions of the null space and range.
    Matrices: The concepts of column space, row space, and null space of a matrix are directly tied to spanning sets and dimensions. Change of basis operations are performed using matrices.
    Eigenvalues and Eigenvectors: You'll encounter eigenspaces, which are subspaces, and their dimensions play a crucial role in diagonalization and understanding the structure of linear operators.
    Inner Product Spaces: When you move to inner product spaces, you'll learn about orthogonal and orthonormal bases, which simplify many calculations and theoretical developments.
    * Abstract Vector Spaces: The concepts of basis and dimension are universal. You'll apply them to more abstract vector spaces like spaces of functions, matrices, and sequences.

    Mastering Basis and Dimension will equip you to navigate the complexities of higher-level linear algebra with confidence. Keep practicing, and you'll see how these ideas connect and simplify many problems.

    🎯 Key Points to Remember

    • Master the core concepts in Basis and Dimension before moving to advanced topics
    • Practice with previous year questions to understand exam patterns
    • Review short notes regularly for quick revision before exams

    Related Topics in Linear Algebra

    More Resources

    Why Choose MastersUp?

    🎯

    AI-Powered Plans

    Personalized study schedules based on your exam date and learning pace

    📚

    15,000+ Questions

    Verified questions with detailed solutions from past papers

    📊

    Smart Analytics

    Track your progress with subject-wise performance insights

    🔖

    Bookmark & Revise

    Save important questions for quick revision before exams

    Start Your Free Preparation →

    No credit card required • Free forever for basic features